C11H11NO4 — CID 18961179
4-(1,3-benzodioxol-5-yl)-1-hydroxypyrrolidin-2-one (PubChem CID 18961179) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-1-hydroxypyrrolidin-2-one.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-1-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 18961179 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-1-hydroxypyrrolidin-2-one |
| SMILES | O=C1CC(c2ccc3c(c2)OCO3)CN1O |
| InChI | InChI=1S/C11H11NO4/c13-11-4-8(5-12(11)14)7-1-2-9-10(3-7)16-6-15-9/h1-3,8,14H,4-6H2 |
| InChIKey | RKYZHBMTXHQMLR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|