About (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one
(4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one (PubChem CID 6540066) has the molecular formula C16H12O5
and a molecular weight of 284.27 g/mol. Its IUPAC name is (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one.
Molecular Properties
| Compound Name | (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one |
| PubChem CID | 6540066 |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one |
| SMILES | O=C1C[C@@H](c2ccc3c(c2)OCO3)c2c(O)cccc2O1 |
| InChI | InChI=1S/C16H12O5/c17-11-2-1-3-13-16(11)10(7-15(18)21-13)9-4-5-12-14(6-9)20-8-19-12/h1-6,10,17H,7-8H2/t10-/m0/s1 |
| InChIKey | VKSANQALQLCMMP-JTQLQIEISA-N |
| XLogP | 2.56 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one?
The IUPAC name of (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one (CID 6540066) is (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one.
What is the SMILES notation for (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one?
The canonical SMILES for (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one is O=C1C[C@@H](c2ccc3c(c2)OCO3)c2c(O)cccc2O1.
What is the InChIKey of (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one?
The InChIKey is VKSANQALQLCMMP-JTQLQIEISA-N. The full InChI is InChI=1S/C16H12O5/c17-11-2-1-3-13-16(11)10(7-15(18)21-13)9-4-5-12-14(6-9)20-8-19-12/h1-6,10,17H,7-8H2/t10-/m0/s1.
What are the key properties of (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one?
(4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one has a molecular weight of 284.27 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one is sourced from PubChem (CID 6540066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).