C16H12O5 — CID 6540066
(4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one (PubChem CID 6540066) has the molecular formula C16H12O5 and a molecular weight of 284.27 g/mol. Its IUPAC name is (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one.
| Compound Name | (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one |
|---|---|
| PubChem CID | 6540066 |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | (4S)-4-(1,3-benzodioxol-5-yl)-5-hydroxy-3,4-dihydrochromen-2-one |
| SMILES | O=C1C[C@@H](c2ccc3c(c2)OCO3)c2c(O)cccc2O1 |
| InChI | InChI=1S/C16H12O5/c17-11-2-1-3-13-16(11)10(7-15(18)21-13)9-4-5-12-14(6-9)20-8-19-12/h1-6,10,17H,7-8H2/t10-/m0/s1 |
| InChIKey | VKSANQALQLCMMP-JTQLQIEISA-N |
| XLogP | 2.56 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|