C16H11ClO4 — CID 132851246
8-(3-chlorophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one (PubChem CID 132851246) has the molecular formula C16H11ClO4 and a molecular weight of 302.71 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one.
| Compound Name | 8-(3-chlorophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one |
|---|---|
| PubChem CID | 132851246 |
| Molecular Formula | C16H11ClO4 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 8-(3-chlorophenyl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one |
| SMILES | O=C1CC(c2cccc(Cl)c2)c2cc3c(cc2O1)OCO3 |
| InChI | InChI=1S/C16H11ClO4/c17-10-3-1-2-9(4-10)11-6-16(18)21-13-7-15-14(5-12(11)13)19-8-20-15/h1-5,7,11H,6,8H2 |
| InChIKey | ICYAOXMNTVWOBU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|