C25H16O8 — CID 91638077
10-(1,3-benzodioxol-5-yl)-5-hydroxy-2-(4-hydroxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 91638077) has the molecular formula C25H16O8 and a molecular weight of 444.40 g/mol. Its IUPAC name is 10-(1,3-benzodioxol-5-yl)-5-hydroxy-2-(4-hydroxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 10-(1,3-benzodioxol-5-yl)-5-hydroxy-2-(4-hydroxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 91638077 |
| Molecular Formula | C25H16O8 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | 10-(1,3-benzodioxol-5-yl)-5-hydroxy-2-(4-hydroxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1CC(c2ccc3c(c2)OCO3)c2c(cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc23)O1 |
| InChI | InChI=1S/C25H16O8/c26-14-4-1-12(2-5-14)19-9-16(27)24-17(28)10-21-23(25(24)33-19)15(8-22(29)32-21)13-3-6-18-20(7-13)31-11-30-18/h1-7,9-10,15,26,28H,8,11H2 |
| InChIKey | ONLWJYIOTOFODR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|