C24H16O6 — CID 97424900
(10R)-5-hydroxy-10-(3-hydroxyphenyl)-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97424900) has the molecular formula C24H16O6 and a molecular weight of 400.39 g/mol. Its IUPAC name is (10R)-5-hydroxy-10-(3-hydroxyphenyl)-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-5-hydroxy-10-(3-hydroxyphenyl)-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97424900 |
| Molecular Formula | C24H16O6 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | (10R)-5-hydroxy-10-(3-hydroxyphenyl)-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1C[C@H](c2cccc(O)c2)c2c(cc(O)c3c(=O)cc(-c4ccccc4)oc23)O1 |
| InChI | InChI=1S/C24H16O6/c25-15-8-4-7-14(9-15)16-10-21(28)29-20-12-18(27)23-17(26)11-19(30-24(23)22(16)20)13-5-2-1-3-6-13/h1-9,11-12,16,25,27H,10H2/t16-/m1/s1 |
| InChIKey | JJWSFBNOCLGOQV-MRXNPFEDSA-N |
| XLogP | 4.31 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|