C26H18O8 — CID 99989995
methyl 4-[(10R)-5-hydroxy-2-(4-hydroxyphenyl)-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]benzoate (PubChem CID 99989995) has the molecular formula C26H18O8 and a molecular weight of 458.42 g/mol. Its IUPAC name is methyl 4-[(10R)-5-hydroxy-2-(4-hydroxyphenyl)-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]benzoate.
| Compound Name | methyl 4-[(10R)-5-hydroxy-2-(4-hydroxyphenyl)-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]benzoate |
|---|---|
| PubChem CID | 99989995 |
| Molecular Formula | C26H18O8 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | methyl 4-[(10R)-5-hydroxy-2-(4-hydroxyphenyl)-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]benzoate |
| SMILES | COC(=O)c1ccc([C@H]2CC(=O)Oc3cc(O)c4c(=O)cc(-c5ccc(O)cc5)oc4c32)cc1 |
| InChI | InChI=1S/C26H18O8/c1-32-26(31)15-4-2-13(3-5-15)17-10-22(30)33-21-12-19(29)24-18(28)11-20(34-25(24)23(17)21)14-6-8-16(27)9-7-14/h2-9,11-12,17,27,29H,10H2,1H3/t17-/m1/s1 |
| InChIKey | KXGWHUPEBWJYEJ-QGZVFWFLSA-N |
| XLogP | 4.10 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|