C27H22O7 — CID 91637527
5-hydroxy-2-(4-hydroxyphenyl)-10-(2-propan-2-yloxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 91637527) has the molecular formula C27H22O7 and a molecular weight of 458.47 g/mol. Its IUPAC name is 5-hydroxy-2-(4-hydroxyphenyl)-10-(2-propan-2-yloxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 5-hydroxy-2-(4-hydroxyphenyl)-10-(2-propan-2-yloxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 91637527 |
| Molecular Formula | C27H22O7 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-10-(2-propan-2-yloxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | CC(C)Oc1ccccc1C1CC(=O)Oc2cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc3c21 |
| InChI | InChI=1S/C27H22O7/c1-14(2)32-21-6-4-3-5-17(21)18-11-24(31)33-23-13-20(30)26-19(29)12-22(34-27(26)25(18)23)15-7-9-16(28)10-8-15/h3-10,12-14,18,28,30H,11H2,1-2H3 |
| InChIKey | MSDRTRNIKFWFIC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|