C24H16O7 — CID 91637265
5-hydroxy-10-(3-hydroxyphenyl)-2-(4-hydroxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 91637265) has the molecular formula C24H16O7 and a molecular weight of 416.39 g/mol. Its IUPAC name is 5-hydroxy-10-(3-hydroxyphenyl)-2-(4-hydroxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 5-hydroxy-10-(3-hydroxyphenyl)-2-(4-hydroxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 91637265 |
| Molecular Formula | C24H16O7 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 5-hydroxy-10-(3-hydroxyphenyl)-2-(4-hydroxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1CC(c2cccc(O)c2)c2c(cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc23)O1 |
| InChI | InChI=1S/C24H16O7/c25-14-6-4-12(5-7-14)19-10-17(27)23-18(28)11-20-22(24(23)31-19)16(9-21(29)30-20)13-2-1-3-15(26)8-13/h1-8,10-11,16,25-26,28H,9H2 |
| InChIKey | HJSSYVBAEAMBRQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|