C25H16O9 — CID 97425507
4-[(10S)-2-(3,4-dihydroxyphenyl)-5-hydroxy-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]benzoic acid (PubChem CID 97425507) has the molecular formula C25H16O9 and a molecular weight of 460.39 g/mol. Its IUPAC name is 4-[(10S)-2-(3,4-dihydroxyphenyl)-5-hydroxy-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]benzoic acid.
| Compound Name | 4-[(10S)-2-(3,4-dihydroxyphenyl)-5-hydroxy-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]benzoic acid |
|---|---|
| PubChem CID | 97425507 |
| Molecular Formula | C25H16O9 |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | 4-[(10S)-2-(3,4-dihydroxyphenyl)-5-hydroxy-4,8-dioxo-9,10-dihydropyrano[2,3-h]chromen-10-yl]benzoic acid |
| SMILES | O=C1C[C@@H](c2ccc(C(=O)O)cc2)c2c(cc(O)c3c(=O)cc(-c4ccc(O)c(O)c4)oc23)O1 |
| InChI | InChI=1S/C25H16O9/c26-15-6-5-13(7-16(15)27)19-9-17(28)23-18(29)10-20-22(24(23)34-19)14(8-21(30)33-20)11-1-3-12(4-2-11)25(31)32/h1-7,9-10,14,26-27,29H,8H2,(H,31,32)/t14-/m0/s1 |
| InChIKey | COKHQSBELXEBTA-AWEZNQCLSA-N |
| XLogP | 3.72 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|