C26H20O9 — CID 71827011
2-(3,4-dihydroxyphenyl)-10-(2,3-dimethoxyphenyl)-5-hydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 71827011) has the molecular formula C26H20O9 and a molecular weight of 476.44 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-10-(2,3-dimethoxyphenyl)-5-hydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 2-(3,4-dihydroxyphenyl)-10-(2,3-dimethoxyphenyl)-5-hydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 71827011 |
| Molecular Formula | C26H20O9 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-10-(2,3-dimethoxyphenyl)-5-hydroxy-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1cccc(C2CC(=O)Oc3cc(O)c4c(=O)cc(-c5ccc(O)c(O)c5)oc4c32)c1OC |
| InChI | InChI=1S/C26H20O9/c1-32-19-5-3-4-13(25(19)33-2)14-9-22(31)34-21-11-18(30)24-17(29)10-20(35-26(24)23(14)21)12-6-7-15(27)16(28)8-12/h3-8,10-11,14,27-28,30H,9H2,1-2H3 |
| InChIKey | BEBKDZODXNFLFY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|