C28H24O8 — CID 97425608
(10S)-5-methoxy-2-phenyl-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97425608) has the molecular formula C28H24O8 and a molecular weight of 488.49 g/mol. Its IUPAC name is (10S)-5-methoxy-2-phenyl-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10S)-5-methoxy-2-phenyl-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97425608 |
| Molecular Formula | C28H24O8 |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | (10S)-5-methoxy-2-phenyl-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc([C@@H]2CC(=O)Oc3cc(OC)c4c(=O)cc(-c5ccccc5)oc4c32)c(OC)c1OC |
| InChI | InChI=1S/C28H24O8/c1-31-19-11-10-16(26(33-3)27(19)34-4)17-12-23(30)35-22-14-21(32-2)25-18(29)13-20(36-28(25)24(17)22)15-8-6-5-7-9-15/h5-11,13-14,17H,12H2,1-4H3/t17-/m0/s1 |
| InChIKey | PPRWLUGDGYXMOK-KRWDZBQOSA-N |
| XLogP | 4.94 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|