C27H20O7 — CID 97423808
(10S)-10-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methoxy-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97423808) has the molecular formula C27H20O7 and a molecular weight of 456.45 g/mol. Its IUPAC name is (10S)-10-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methoxy-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10S)-10-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methoxy-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97423808 |
| Molecular Formula | C27H20O7 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | (10S)-10-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methoxy-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1cc2c(c3oc(-c4ccccc4)cc(=O)c13)[C@H](c1ccc3c(c1)OCCO3)CC(=O)O2 |
| InChI | InChI=1S/C27H20O7/c1-30-22-14-23-25(27-26(22)18(28)13-20(34-27)15-5-3-2-4-6-15)17(12-24(29)33-23)16-7-8-19-21(11-16)32-10-9-31-19/h2-8,11,13-14,17H,9-10,12H2,1H3/t17-/m0/s1 |
| InChIKey | FWKMCDIBUNXKMZ-KRWDZBQOSA-N |
| XLogP | 4.68 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|