C25H18O8 — CID 71827308
5,6-dihydroxy-10-(4-hydroxy-3-methoxyphenyl)-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 71827308) has the molecular formula C25H18O8 and a molecular weight of 446.41 g/mol. Its IUPAC name is 5,6-dihydroxy-10-(4-hydroxy-3-methoxyphenyl)-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 5,6-dihydroxy-10-(4-hydroxy-3-methoxyphenyl)-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 71827308 |
| Molecular Formula | C25H18O8 |
| Molecular Weight | 446.41 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 5,6-dihydroxy-10-(4-hydroxy-3-methoxyphenyl)-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1cc(C2CC(=O)Oc3c(O)c(O)c4c(=O)cc(-c5ccccc5)oc4c32)ccc1O |
| InChI | InChI=1S/C25H18O8/c1-31-18-9-13(7-8-15(18)26)14-10-19(28)33-25-20(14)24-21(22(29)23(25)30)16(27)11-17(32-24)12-5-3-2-4-6-12/h2-9,11,14,26,29-30H,10H2,1H3 |
| InChIKey | SOWHRAGUTSEBIG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|