C35H30O8 — CID 71826725
5,6-dihydroxy-10-[4-methoxy-3-[(4-propan-2-ylphenyl)methoxy]phenyl]-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 71826725) has the molecular formula C35H30O8 and a molecular weight of 578.62 g/mol. Its IUPAC name is 5,6-dihydroxy-10-[4-methoxy-3-[(4-propan-2-ylphenyl)methoxy]phenyl]-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 5,6-dihydroxy-10-[4-methoxy-3-[(4-propan-2-ylphenyl)methoxy]phenyl]-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 71826725 |
| Molecular Formula | C35H30O8 |
| Molecular Weight | 578.62 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | 5,6-dihydroxy-10-[4-methoxy-3-[(4-propan-2-ylphenyl)methoxy]phenyl]-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc(C2CC(=O)Oc3c(O)c(O)c4c(=O)cc(-c5ccccc5)oc4c32)cc1OCc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C35H30O8/c1-19(2)21-11-9-20(10-12-21)18-41-28-15-23(13-14-26(28)40-3)24-16-29(37)43-35-30(24)34-31(32(38)33(35)39)25(36)17-27(42-34)22-7-5-4-6-8-22/h4-15,17,19,24,38-39H,16,18H2,1-3H3 |
| InChIKey | NLVPZYHNNHBKTN-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.62 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|