C23H15NO6 — CID 97423998
(10S)-5,6-dihydroxy-2-phenyl-10-pyridin-4-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97423998) has the molecular formula C23H15NO6 and a molecular weight of 401.37 g/mol. Its IUPAC name is (10S)-5,6-dihydroxy-2-phenyl-10-pyridin-4-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10S)-5,6-dihydroxy-2-phenyl-10-pyridin-4-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97423998 |
| Molecular Formula | C23H15NO6 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | (10S)-5,6-dihydroxy-2-phenyl-10-pyridin-4-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1C[C@@H](c2ccncc2)c2c(c(O)c(O)c3c(=O)cc(-c4ccccc4)oc23)O1 |
| InChI | InChI=1S/C23H15NO6/c25-15-11-16(13-4-2-1-3-5-13)29-22-18-14(12-6-8-24-9-7-12)10-17(26)30-23(18)21(28)20(27)19(15)22/h1-9,11,14,27-28H,10H2/t14-/m0/s1 |
| InChIKey | MJTFGJNFTZONSL-AWEZNQCLSA-N |
| XLogP | 3.71 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|