C27H16O8 — CID 97423817
(10S)-5,6-dihydroxy-10-(4-oxochromen-3-yl)-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97423817) has the molecular formula C27H16O8 and a molecular weight of 468.42 g/mol. Its IUPAC name is (10S)-5,6-dihydroxy-10-(4-oxochromen-3-yl)-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10S)-5,6-dihydroxy-10-(4-oxochromen-3-yl)-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97423817 |
| Molecular Formula | C27H16O8 |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 468.08 |
| IUPAC Name | (10S)-5,6-dihydroxy-10-(4-oxochromen-3-yl)-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1C[C@H](c2coc3ccccc3c2=O)c2c(c(O)c(O)c3c(=O)cc(-c4ccccc4)oc23)O1 |
| InChI | InChI=1S/C27H16O8/c28-17-11-19(13-6-2-1-3-7-13)34-26-21-15(10-20(29)35-27(21)25(32)24(31)22(17)26)16-12-33-18-9-5-4-8-14(18)23(16)30/h1-9,11-12,15,31-32H,10H2/t15-/m1/s1 |
| InChIKey | FAGYRKURRITTCW-OAHLLOKOSA-N |
| XLogP | 4.42 |
| TPSA | 127.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|