C24H13F3O6 — CID 97426239
(10S)-5,6-dihydroxy-2-phenyl-10-(2,3,4-trifluorophenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97426239) has the molecular formula C24H13F3O6 and a molecular weight of 454.36 g/mol. Its IUPAC name is (10S)-5,6-dihydroxy-2-phenyl-10-(2,3,4-trifluorophenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10S)-5,6-dihydroxy-2-phenyl-10-(2,3,4-trifluorophenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97426239 |
| Molecular Formula | C24H13F3O6 |
| Molecular Weight | 454.36 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | (10S)-5,6-dihydroxy-2-phenyl-10-(2,3,4-trifluorophenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1C[C@H](c2ccc(F)c(F)c2F)c2c(c(O)c(O)c3c(=O)cc(-c4ccccc4)oc23)O1 |
| InChI | InChI=1S/C24H13F3O6/c25-13-7-6-11(19(26)20(13)27)12-8-16(29)33-24-17(12)23-18(21(30)22(24)31)14(28)9-15(32-23)10-4-2-1-3-5-10/h1-7,9,12,30-31H,8H2/t12-/m1/s1 |
| InChIKey | GLDACDMBZVXPOM-GFCCVEGCSA-N |
| XLogP | 4.73 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|