C26H16N2O6 — CID 71826018
5,6-dihydroxy-2-phenyl-10-quinoxalin-5-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 71826018) has the molecular formula C26H16N2O6 and a molecular weight of 452.42 g/mol. Its IUPAC name is 5,6-dihydroxy-2-phenyl-10-quinoxalin-5-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 5,6-dihydroxy-2-phenyl-10-quinoxalin-5-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 71826018 |
| Molecular Formula | C26H16N2O6 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 5,6-dihydroxy-2-phenyl-10-quinoxalin-5-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1CC(c2cccc3nccnc23)c2c(c(O)c(O)c3c(=O)cc(-c4ccccc4)oc23)O1 |
| InChI | InChI=1S/C26H16N2O6/c29-17-12-18(13-5-2-1-3-6-13)33-25-20-15(14-7-4-8-16-22(14)28-10-9-27-16)11-19(30)34-26(20)24(32)23(31)21(17)25/h1-10,12,15,31-32H,11H2 |
| InChIKey | VKLLOFFWHHBLGD-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|