C24H17NO7 — CID 97487873
methyl 2-[(18R)-8,9-dihydroxy-6-oxo-4-phenyl-3,11-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-1,4,7,9,12(17),13,15-heptaen-18-yl]acetate (PubChem CID 97487873) has the molecular formula C24H17NO7 and a molecular weight of 431.40 g/mol. Its IUPAC name is methyl 2-[(18R)-8,9-dihydroxy-6-oxo-4-phenyl-3,11-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-1,4,7,9,12(17),13,15-heptaen-18-yl]acetate.
| Compound Name | methyl 2-[(18R)-8,9-dihydroxy-6-oxo-4-phenyl-3,11-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-1,4,7,9,12(17),13,15-heptaen-18-yl]acetate |
|---|---|
| PubChem CID | 97487873 |
| Molecular Formula | C24H17NO7 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | methyl 2-[(18R)-8,9-dihydroxy-6-oxo-4-phenyl-3,11-dioxa-13-azatetracyclo[8.8.0.02,7.012,17]octadeca-1,4,7,9,12(17),13,15-heptaen-18-yl]acetate |
| SMILES | COC(=O)C[C@H]1c2cccnc2Oc2c(O)c(O)c3c(=O)cc(-c4ccccc4)oc3c21 |
| InChI | InChI=1S/C24H17NO7/c1-30-17(27)10-14-13-8-5-9-25-24(13)32-23-18(14)22-19(20(28)21(23)29)15(26)11-16(31-22)12-6-3-2-4-7-12/h2-9,11,14,28-29H,10H2,1H3/t14-/m0/s1 |
| InChIKey | YRYFETJUZSNNOB-AWEZNQCLSA-N |
| XLogP | 4.07 |
| TPSA | 119.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|