C27H20O9 — CID 97425235
methyl 2-[2-[(10R)-5,6-dihydroxy-4,8-dioxo-2-phenyl-9,10-dihydropyrano[2,3-h]chromen-10-yl]phenoxy]acetate (PubChem CID 97425235) has the molecular formula C27H20O9 and a molecular weight of 488.45 g/mol. Its IUPAC name is methyl 2-[2-[(10R)-5,6-dihydroxy-4,8-dioxo-2-phenyl-9,10-dihydropyrano[2,3-h]chromen-10-yl]phenoxy]acetate.
| Compound Name | methyl 2-[2-[(10R)-5,6-dihydroxy-4,8-dioxo-2-phenyl-9,10-dihydropyrano[2,3-h]chromen-10-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 97425235 |
| Molecular Formula | C27H20O9 |
| Molecular Weight | 488.45 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | methyl 2-[2-[(10R)-5,6-dihydroxy-4,8-dioxo-2-phenyl-9,10-dihydropyrano[2,3-h]chromen-10-yl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccccc1[C@H]1CC(=O)Oc2c(O)c(O)c3c(=O)cc(-c4ccccc4)oc3c21 |
| InChI | InChI=1S/C27H20O9/c1-33-21(30)13-34-18-10-6-5-9-15(18)16-11-20(29)36-27-22(16)26-23(24(31)25(27)32)17(28)12-19(35-26)14-7-3-2-4-8-14/h2-10,12,16,31-32H,11,13H2,1H3/t16-/m1/s1 |
| InChIKey | CLAFEYSEICVBNZ-MRXNPFEDSA-N |
| XLogP | 3.86 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|