C25H16O8 — CID 97425128
(10R)-10-(1,3-benzodioxol-5-yl)-5,6-dihydroxy-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97425128) has the molecular formula C25H16O8 and a molecular weight of 444.40 g/mol. Its IUPAC name is (10R)-10-(1,3-benzodioxol-5-yl)-5,6-dihydroxy-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-10-(1,3-benzodioxol-5-yl)-5,6-dihydroxy-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97425128 |
| Molecular Formula | C25H16O8 |
| Molecular Weight | 444.40 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | (10R)-10-(1,3-benzodioxol-5-yl)-5,6-dihydroxy-2-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1C[C@H](c2ccc3c(c2)OCO3)c2c(c(O)c(O)c3c(=O)cc(-c4ccccc4)oc23)O1 |
| InChI | InChI=1S/C25H16O8/c26-15-10-17(12-4-2-1-3-5-12)32-24-20-14(13-6-7-16-18(8-13)31-11-30-16)9-19(27)33-25(20)23(29)22(28)21(15)24/h1-8,10,14,28-29H,9,11H2/t14-/m1/s1 |
| InChIKey | WFJSPEUJUTTXLH-CQSZACIVSA-N |
| XLogP | 4.04 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|