C27H20O7 — CID 71827106
methyl 4-(5-methoxy-4,8-dioxo-2-phenyl-9,10-dihydropyrano[2,3-h]chromen-10-yl)benzoate (PubChem CID 71827106) has the molecular formula C27H20O7 and a molecular weight of 456.45 g/mol. Its IUPAC name is methyl 4-(5-methoxy-4,8-dioxo-2-phenyl-9,10-dihydropyrano[2,3-h]chromen-10-yl)benzoate.
| Compound Name | methyl 4-(5-methoxy-4,8-dioxo-2-phenyl-9,10-dihydropyrano[2,3-h]chromen-10-yl)benzoate |
|---|---|
| PubChem CID | 71827106 |
| Molecular Formula | C27H20O7 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | methyl 4-(5-methoxy-4,8-dioxo-2-phenyl-9,10-dihydropyrano[2,3-h]chromen-10-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2CC(=O)Oc3cc(OC)c4c(=O)cc(-c5ccccc5)oc4c32)cc1 |
| InChI | InChI=1S/C27H20O7/c1-31-21-14-22-24(26-25(21)19(28)13-20(34-26)16-6-4-3-5-7-16)18(12-23(29)33-22)15-8-10-17(11-9-15)27(30)32-2/h3-11,13-14,18H,12H2,1-2H3 |
| InChIKey | TUSAWBKOSJDKSL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|