C27H22O8 — CID 97424731
(10S)-5-hydroxy-2-phenyl-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 97424731) has the molecular formula C27H22O8 and a molecular weight of 474.47 g/mol. Its IUPAC name is (10S)-5-hydroxy-2-phenyl-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10S)-5-hydroxy-2-phenyl-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 97424731 |
| Molecular Formula | C27H22O8 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | (10S)-5-hydroxy-2-phenyl-10-(2,3,4-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | COc1ccc([C@@H]2CC(=O)Oc3cc(O)c4c(=O)cc(-c5ccccc5)oc4c32)c(OC)c1OC |
| InChI | InChI=1S/C27H22O8/c1-31-19-10-9-15(25(32-2)26(19)33-3)16-11-22(30)34-21-13-18(29)24-17(28)12-20(35-27(24)23(16)21)14-7-5-4-6-8-14/h4-10,12-13,16,29H,11H2,1-3H3/t16-/m0/s1 |
| InChIKey | BHIKRVFJIGDZEN-INIZCTEOSA-N |
| XLogP | 4.63 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|