C11H9NO3S — CID 169153251
4,6-dioxa-12-thia-10-azatetracyclo[7.6.0.03,7.010,13]pentadeca-1,3(7),8-trien-15-one (PubChem CID 169153251) has the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. Its IUPAC name is 4,6-dioxa-12-thia-10-azatetracyclo[7.6.0.03,7.010,13]pentadeca-1,3(7),8-trien-15-one.
| Compound Name | 4,6-dioxa-12-thia-10-azatetracyclo[7.6.0.03,7.010,13]pentadeca-1,3(7),8-trien-15-one |
|---|---|
| PubChem CID | 169153251 |
| Molecular Formula | C11H9NO3S |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 4,6-dioxa-12-thia-10-azatetracyclo[7.6.0.03,7.010,13]pentadeca-1,3(7),8-trien-15-one |
| SMILES | O=C1CC2SCN2c2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C11H9NO3S/c13-8-3-11-12(4-16-11)7-2-10-9(1-6(7)8)14-5-15-10/h1-2,11H,3-5H2 |
| InChIKey | KKWGZGKWRLDWFL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|