C13H11NO4 — CID 10800377
4-methyl-3,12,14-trioxa-2-azatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),5,9,11(15)-tetraen-8-one (PubChem CID 10800377) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is 4-methyl-3,12,14-trioxa-2-azatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),5,9,11(15)-tetraen-8-one.
| Compound Name | 4-methyl-3,12,14-trioxa-2-azatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),5,9,11(15)-tetraen-8-one |
|---|---|
| PubChem CID | 10800377 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 4-methyl-3,12,14-trioxa-2-azatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),5,9,11(15)-tetraen-8-one |
| SMILES | CC1C=CC2C(=O)c3cc4c(cc3N2O1)OCO4 |
| InChI | InChI=1S/C13H11NO4/c1-7-2-3-9-13(15)8-4-11-12(17-6-16-11)5-10(8)14(9)18-7/h2-5,7,9H,6H2,1H3 |
| InChIKey | SYJOMAYCDFSXOP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|