About 5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one
5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one (PubChem CID 135021934) has the molecular formula C10H9NO4
and a molecular weight of 207.18 g/mol. Its IUPAC name is 5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one.
Molecular Properties
| Compound Name | 5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one |
| PubChem CID | 135021934 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one |
| SMILES | CON1C(=O)Cc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C10H9NO4/c1-13-11-7-4-9-8(14-5-15-9)2-6(7)3-10(11)12/h2,4H,3,5H2,1H3 |
| InChIKey | LNPPEDRSPKBWNK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.18 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one?
The IUPAC name of 5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one (CID 135021934) is 5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one.
What is the SMILES notation for 5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one?
The canonical SMILES for 5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one is CON1C(=O)Cc2cc3c(cc21)OCO3.
What is the InChIKey of 5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one?
The InChIKey is LNPPEDRSPKBWNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO4/c1-13-11-7-4-9-8(14-5-15-9)2-6(7)3-10(11)12/h2,4H,3,5H2,1H3.
What are the key properties of 5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one?
5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one has a molecular weight of 207.18 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-7H-[1,3]dioxolo[4,5-f]indol-6-one is sourced from PubChem (CID 135021934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).