C21H21NO7 — CID 102205365
(3S,7R)-2-(2,4,6-trimethoxyphenyl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),9,11(15)-trien-4-one (PubChem CID 102205365) has the molecular formula C21H21NO7 and a molecular weight of 399.40 g/mol. Its IUPAC name is (3S,7R)-2-(2,4,6-trimethoxyphenyl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),9,11(15)-trien-4-one.
| Compound Name | (3S,7R)-2-(2,4,6-trimethoxyphenyl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),9,11(15)-trien-4-one |
|---|---|
| PubChem CID | 102205365 |
| Molecular Formula | C21H21NO7 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (3S,7R)-2-(2,4,6-trimethoxyphenyl)-5,12,14-trioxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(16),9,11(15)-trien-4-one |
| SMILES | COc1cc(OC)c(N2c3cc4c(cc3C[C@H]3COC(=O)[C@H]32)OCO4)c(OC)c1 |
| InChI | InChI=1S/C21H21NO7/c1-24-13-6-17(25-2)20(18(7-13)26-3)22-14-8-16-15(28-10-29-16)5-11(14)4-12-9-27-21(23)19(12)22/h5-8,12,19H,4,9-10H2,1-3H3/t12-,19-/m0/s1 |
| InChIKey | REAQDRWGEDPVTN-BUXKBTBVSA-N |
| XLogP | 2.68 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |