C28H25NO8 — CID 10141899
[4-[(5R,5aR,8aR)-6-oxo-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]-2,6-dimethoxyphenyl] N-phenylcarbamate (PubChem CID 10141899) has the molecular formula C28H25NO8 and a molecular weight of 503.51 g/mol. Its IUPAC name is [4-[(5R,5aR,8aR)-6-oxo-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]-2,6-dimethoxyphenyl] N-phenylcarbamate.
| Compound Name | [4-[(5R,5aR,8aR)-6-oxo-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]-2,6-dimethoxyphenyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 10141899 |
| Molecular Formula | C28H25NO8 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | [4-[(5R,5aR,8aR)-6-oxo-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-5-yl]-2,6-dimethoxyphenyl] N-phenylcarbamate |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3C[C@H]3COC(=O)[C@@H]32)OCO4)cc(OC)c1OC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H25NO8/c1-32-22-10-16(11-23(33-2)26(22)37-28(31)29-18-6-4-3-5-7-18)24-19-12-21-20(35-14-36-21)9-15(19)8-17-13-34-27(30)25(17)24/h3-7,9-12,17,24-25H,8,13-14H2,1-2H3,(H,29,31)/t17-,24+,25-/m0/s1 |
| InChIKey | DEQMKLODIIHTFU-AJHZIAPWSA-N |
| XLogP | 4.52 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |