C20H18O5 — CID 139235908
(5R,5aR,8aR)-5-(2-methoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one (PubChem CID 139235908) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is (5R,5aR,8aR)-5-(2-methoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one.
| Compound Name | (5R,5aR,8aR)-5-(2-methoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one |
|---|---|
| PubChem CID | 139235908 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (5R,5aR,8aR)-5-(2-methoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one |
| SMILES | COc1ccccc1[C@H]1c2cc3c(cc2C[C@H]2COC(=O)[C@@H]21)OCO3 |
| InChI | InChI=1S/C20H18O5/c1-22-15-5-3-2-4-13(15)19-14-8-17-16(24-10-25-17)7-11(14)6-12-9-23-20(21)18(12)19/h2-5,7-8,12,18-19H,6,9-10H2,1H3/t12-,18-,19-/m0/s1 |
| InChIKey | CHXRYNUAHWHEFZ-NXXSPTCGSA-N |
| XLogP | 2.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |