C20H18O7 — CID 10429221
(5R,5aR)-5-(3,4-dihydroxy-5-methoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one (PubChem CID 10429221) has the molecular formula C20H18O7 and a molecular weight of 370.36 g/mol. Its IUPAC name is (5R,5aR)-5-(3,4-dihydroxy-5-methoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one.
| Compound Name | (5R,5aR)-5-(3,4-dihydroxy-5-methoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one |
|---|---|
| PubChem CID | 10429221 |
| Molecular Formula | C20H18O7 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (5R,5aR)-5-(3,4-dihydroxy-5-methoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3CC3COC(=O)[C@@H]32)OCO4)cc(O)c1O |
| InChI | InChI=1S/C20H18O7/c1-24-16-5-10(3-13(21)19(16)22)17-12-6-15-14(26-8-27-15)4-9(12)2-11-7-25-20(23)18(11)17/h3-6,11,17-18,21-22H,2,7-8H2,1H3/t11?,17-,18+/m1/s1 |
| InChIKey | CMEVNHJURVJZLV-CIAGWNDSSA-N |
| XLogP | 2.31 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|