C24H24O9 — CID 11123318
methyl (5R,5aS,8aR)-6-oxo-5-(3,4,5-trimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxole-2-carboxylate (PubChem CID 11123318) has the molecular formula C24H24O9 and a molecular weight of 456.45 g/mol. Its IUPAC name is methyl (5R,5aS,8aR)-6-oxo-5-(3,4,5-trimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxole-2-carboxylate.
| Compound Name | methyl (5R,5aS,8aR)-6-oxo-5-(3,4,5-trimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxole-2-carboxylate |
|---|---|
| PubChem CID | 11123318 |
| Molecular Formula | C24H24O9 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | methyl (5R,5aS,8aR)-6-oxo-5-(3,4,5-trimethoxyphenyl)-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxole-2-carboxylate |
| SMILES | COC(=O)C1Oc2cc3c(cc2O1)[C@@H](c1cc(OC)c(OC)c(OC)c1)[C@@H]1C(=O)OC[C@@H]1C3 |
| InChI | InChI=1S/C24H24O9/c1-27-17-7-12(8-18(28-2)21(17)29-3)19-14-9-16-15(32-24(33-16)23(26)30-4)6-11(14)5-13-10-31-22(25)20(13)19/h6-9,13,19-20,24H,5,10H2,1-4H3/t13-,19+,20+,24?/m0/s1 |
| InChIKey | UGTNOQJAQSBVEP-FYONYHPZSA-N |
| XLogP | 2.46 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |