C29H29NO6 — CID 171535272
5-[4-[2-(4-aminophenyl)ethyl]-3,5-dimethoxyphenyl]-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one (PubChem CID 171535272) has the molecular formula C29H29NO6 and a molecular weight of 487.55 g/mol. Its IUPAC name is 5-[4-[2-(4-aminophenyl)ethyl]-3,5-dimethoxyphenyl]-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one.
| Compound Name | 5-[4-[2-(4-aminophenyl)ethyl]-3,5-dimethoxyphenyl]-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one |
|---|---|
| PubChem CID | 171535272 |
| Molecular Formula | C29H29NO6 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 5-[4-[2-(4-aminophenyl)ethyl]-3,5-dimethoxyphenyl]-5a,8,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-6-one |
| SMILES | COc1cc(C2c3cc4c(cc3CC3COC(=O)C32)OCO4)cc(OC)c1CCc1ccc(N)cc1 |
| InChI | InChI=1S/C29H29NO6/c1-32-23-11-18(12-24(33-2)21(23)8-5-16-3-6-20(30)7-4-16)27-22-13-26-25(35-15-36-26)10-17(22)9-19-14-34-29(31)28(19)27/h3-4,6-7,10-13,19,27-28H,5,8-9,14-15,30H2,1-2H3 |
| InChIKey | LNARJZGQYLLSKQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|