C34H41N2O11 — CID 52941740
CID 52941740 (PubChem CID 52941740) has the molecular formula C34H41N2O11 and a molecular weight of 653.71 g/mol.
| Compound Name | CID 52941740 |
|---|---|
| PubChem CID | 52941740 |
| Molecular Formula | C34H41N2O11 |
| Molecular Weight | 653.71 g/mol |
| Exact Mass | 653.27 |
| IUPAC Name | — |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3C[C@H]3COC(=O)[C@@H]32)OCO4)cc(OC)c1OC(=O)[C@H](C)NC(=O)OC1CC(C)(C)N([O])C(C)(C)C1 |
| InChI | InChI=1S/C34H41N2O11/c1-17(35-32(39)46-21-13-33(2,3)36(40)34(4,5)14-21)30(37)47-29-25(41-6)10-19(11-26(29)42-7)27-22-12-24-23(44-16-45-24)9-18(22)8-20-15-43-31(38)28(20)27/h9-12,17,20-21,27-28H,8,13-16H2,1-7H3,(H,35,39)/t17-,20-,27+,28-/m0/s1 |
| InChIKey | IJMYYSJMCZTROF-DCUXWYIKSA-N |
| XLogP | 4.30 |
| TPSA | 150.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.71 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|