C37H48N3O11 — CID 46216806
CID 46216806 (PubChem CID 46216806) has the molecular formula C37H48N3O11 and a molecular weight of 710.80 g/mol.
| Compound Name | CID 46216806 |
|---|---|
| PubChem CID | 46216806 |
| Molecular Formula | C37H48N3O11 |
| Molecular Weight | 710.80 g/mol |
| Exact Mass | 710.33 |
| IUPAC Name | — |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](NC(=O)[C@H](CC(C)C)NC(=O)OC3CC(C)(C)N([O])C(C)(C)C3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1O |
| InChI | InChI=1S/C37H48N3O11/c1-18(2)9-24(38-35(44)51-20-14-36(3,4)40(45)37(5,6)15-20)33(42)39-31-22-13-26-25(49-17-50-26)12-21(22)29(30-23(31)16-48-34(30)43)19-10-27(46-7)32(41)28(11-19)47-8/h10-13,18,20,23-24,29-31,41H,9,14-17H2,1-8H3,(H,38,44)(H,39,42)/t23-,24-,29+,30-,31+/m0/s1 |
| InChIKey | RREHMBROUCNCHB-MVPYWAIYSA-N |
| XLogP | 4.74 |
| TPSA | 174.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.80 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |