C26H30N2O8 — CID 58349530
N-[(5S,5aS,8aR)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-5-aminopentanamide (PubChem CID 58349530) has the molecular formula C26H30N2O8 and a molecular weight of 498.53 g/mol. Its IUPAC name is N-[(5S,5aS,8aR)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-5-aminopentanamide.
| Compound Name | N-[(5S,5aS,8aR)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-5-aminopentanamide |
|---|---|
| PubChem CID | 58349530 |
| Molecular Formula | C26H30N2O8 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | N-[(5S,5aS,8aR)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-5-aminopentanamide |
| SMILES | COc1cc(C2c3cc4c(cc3[C@@H](NC(=O)CCCCN)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1O |
| InChI | InChI=1S/C26H30N2O8/c1-32-19-7-13(8-20(33-2)25(19)30)22-14-9-17-18(36-12-35-17)10-15(14)24(16-11-34-26(31)23(16)22)28-21(29)5-3-4-6-27/h7-10,16,22-24,30H,3-6,11-12,27H2,1-2H3,(H,28,29)/t16-,22?,23-,24+/m0/s1 |
| InChIKey | WOOAIMIZJVYCSO-IESMXXSNSA-N |
| XLogP | 2.36 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|