C30H39N3O8 — CID 143943770
N-[(5S,8aR)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-3-[2-(diethylamino)ethylamino]propanamide (PubChem CID 143943770) has the molecular formula C30H39N3O8 and a molecular weight of 569.66 g/mol. Its IUPAC name is N-[(5S,8aR)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-3-[2-(diethylamino)ethylamino]propanamide.
| Compound Name | N-[(5S,8aR)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-3-[2-(diethylamino)ethylamino]propanamide |
|---|---|
| PubChem CID | 143943770 |
| Molecular Formula | C30H39N3O8 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.27 |
| IUPAC Name | N-[(5S,8aR)-9-(4-hydroxy-3,5-dimethoxyphenyl)-8-oxo-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-3-[2-(diethylamino)ethylamino]propanamide |
| SMILES | CCN(CC)CCNCCC(=O)N[C@@H]1c2cc3c(cc2C(c2cc(OC)c(O)c(OC)c2)[C@H]2C(=O)OCC21)OCO3 |
| InChI | InChI=1S/C30H39N3O8/c1-5-33(6-2)10-9-31-8-7-25(34)32-28-19-14-22-21(40-16-41-22)13-18(19)26(27-20(28)15-39-30(27)36)17-11-23(37-3)29(35)24(12-17)38-4/h11-14,20,26-28,31,35H,5-10,15-16H2,1-4H3,(H,32,34)/t20?,26?,27-,28+/m0/s1 |
| InChIKey | ILNBQIRRIQIQBU-VNAROETBSA-N |
| XLogP | 2.55 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|