C30H41N3O8 — CID 46178884
N-[(5S,5aS,8aR,9R)-8-hydroxy-9-(4-hydroxy-3,5-dimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-5-(4-aminobutylamino)pentanamide (PubChem CID 46178884) has the molecular formula C30H41N3O8 and a molecular weight of 571.67 g/mol. Its IUPAC name is N-[(5S,5aS,8aR,9R)-8-hydroxy-9-(4-hydroxy-3,5-dimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-5-(4-aminobutylamino)pentanamide.
| Compound Name | N-[(5S,5aS,8aR,9R)-8-hydroxy-9-(4-hydroxy-3,5-dimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-5-(4-aminobutylamino)pentanamide |
|---|---|
| PubChem CID | 46178884 |
| Molecular Formula | C30H41N3O8 |
| Molecular Weight | 571.67 g/mol |
| Exact Mass | 571.29 |
| IUPAC Name | N-[(5S,5aS,8aR,9R)-8-hydroxy-9-(4-hydroxy-3,5-dimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-5-(4-aminobutylamino)pentanamide |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](NC(=O)CCCCNCCCCN)[C@H]3COC(O)[C@H]23)OCO4)cc(OC)c1O |
| InChI | InChI=1S/C30H41N3O8/c1-37-23-11-17(12-24(38-2)29(23)35)26-18-13-21-22(41-16-40-21)14-19(18)28(20-15-39-30(36)27(20)26)33-25(34)7-3-5-9-32-10-6-4-8-31/h11-14,20,26-28,30,32,35-36H,3-10,15-16,31H2,1-2H3,(H,33,34)/t20-,26+,27-,28+,30?/m0/s1 |
| InChIKey | NDCXZPDLYGMGQD-UQLVCKDCSA-N |
| XLogP | 2.52 |
| TPSA | 153.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.67 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|