C32H46N4O8 — CID 46179523
1-[(5S,5aS,8aR,9R)-8-hydroxy-9-(4-hydroxy-3,5-dimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-3-[4-(4-aminobutylamino)hexyl]urea (PubChem CID 46179523) has the molecular formula C32H46N4O8 and a molecular weight of 614.74 g/mol. Its IUPAC name is 1-[(5S,5aS,8aR,9R)-8-hydroxy-9-(4-hydroxy-3,5-dimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-3-[4-(4-aminobutylamino)hexyl]urea.
| Compound Name | 1-[(5S,5aS,8aR,9R)-8-hydroxy-9-(4-hydroxy-3,5-dimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-3-[4-(4-aminobutylamino)hexyl]urea |
|---|---|
| PubChem CID | 46179523 |
| Molecular Formula | C32H46N4O8 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.33 |
| IUPAC Name | 1-[(5S,5aS,8aR,9R)-8-hydroxy-9-(4-hydroxy-3,5-dimethoxyphenyl)-5,5a,6,8,8a,9-hexahydro-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl]-3-[4-(4-aminobutylamino)hexyl]urea |
| SMILES | CCC(CCCNC(=O)N[C@@H]1c2cc3c(cc2[C@@H](c2cc(OC)c(O)c(OC)c2)[C@H]2C(O)OC[C@@H]21)OCO3)NCCCCN |
| InChI | InChI=1S/C32H46N4O8/c1-4-19(34-10-6-5-9-33)8-7-11-35-32(39)36-29-21-15-24-23(43-17-44-24)14-20(21)27(28-22(29)16-42-31(28)38)18-12-25(40-2)30(37)26(13-18)41-3/h12-15,19,22,27-29,31,34,37-38H,4-11,16-17,33H2,1-3H3,(H2,35,36,39)/t19?,22-,27+,28-,29+,31?/m0/s1 |
| InChIKey | LLRUCGYMFJELMH-MNPSKKQSSA-N |
| XLogP | 3.09 |
| TPSA | 165.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|