C31H44N4O8 — CID 89101771
3-[3-(3-aminopropylamino)propylamino]-N-[(6R,7S,8S)-6-formyl-5-(4-hydroxy-3,5-dimethoxyphenyl)-7-(methoxymethyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-8-yl]propanamide (PubChem CID 89101771) has the molecular formula C31H44N4O8 and a molecular weight of 600.71 g/mol. Its IUPAC name is 3-[3-(3-aminopropylamino)propylamino]-N-[(6R,7S,8S)-6-formyl-5-(4-hydroxy-3,5-dimethoxyphenyl)-7-(methoxymethyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-8-yl]propanamide.
| Compound Name | 3-[3-(3-aminopropylamino)propylamino]-N-[(6R,7S,8S)-6-formyl-5-(4-hydroxy-3,5-dimethoxyphenyl)-7-(methoxymethyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-8-yl]propanamide |
|---|---|
| PubChem CID | 89101771 |
| Molecular Formula | C31H44N4O8 |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | 3-[3-(3-aminopropylamino)propylamino]-N-[(6R,7S,8S)-6-formyl-5-(4-hydroxy-3,5-dimethoxyphenyl)-7-(methoxymethyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-8-yl]propanamide |
| SMILES | COC[C@@H]1[C@H](NC(=O)CCNCCCNCCCN)c2cc3c(cc2C(c2cc(OC)c(O)c(OC)c2)[C@H]1C=O)OCO3 |
| InChI | InChI=1S/C31H44N4O8/c1-39-17-23-22(16-36)29(19-12-26(40-2)31(38)27(13-19)41-3)20-14-24-25(43-18-42-24)15-21(20)30(23)35-28(37)6-11-34-10-5-9-33-8-4-7-32/h12-16,22-23,29-30,33-34,38H,4-11,17-18,32H2,1-3H3,(H,35,37)/t22-,23-,29?,30+/m0/s1 |
| InChIKey | OOOXNDBPCVUQGX-YHUSTYTGSA-N |
| XLogP | 1.83 |
| TPSA | 162.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|