C31H42N2O8 — CID 91496923
[5-[3-(hexylamino)propanoylamino]-8-(4-hydroxy-3,5-dimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl acetate (PubChem CID 91496923) has the molecular formula C31H42N2O8 and a molecular weight of 570.68 g/mol. Its IUPAC name is [5-[3-(hexylamino)propanoylamino]-8-(4-hydroxy-3,5-dimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl acetate.
| Compound Name | [5-[3-(hexylamino)propanoylamino]-8-(4-hydroxy-3,5-dimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl acetate |
|---|---|
| PubChem CID | 91496923 |
| Molecular Formula | C31H42N2O8 |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | [5-[3-(hexylamino)propanoylamino]-8-(4-hydroxy-3,5-dimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxol-6-yl]methyl acetate |
| SMILES | CCCCCCNCCC(=O)NC1c2cc3c(cc2C(c2cc(OC)c(O)c(OC)c2)CC1COC(C)=O)OCO3 |
| InChI | InChI=1S/C31H42N2O8/c1-5-6-7-8-10-32-11-9-29(35)33-30-21(17-39-19(2)34)12-22(20-13-27(37-3)31(36)28(14-20)38-4)23-15-25-26(16-24(23)30)41-18-40-25/h13-16,21-22,30,32,36H,5-12,17-18H2,1-4H3,(H,33,35) |
| InChIKey | MHTLDQLHHZZIEU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 124.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|