C23H26O8 — CID 126603546
(5R,7R,8R)-8-hydroxy-7-(methoxymethyl)-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carbaldehyde (PubChem CID 126603546) has the molecular formula C23H26O8 and a molecular weight of 430.45 g/mol. Its IUPAC name is (5R,7R,8R)-8-hydroxy-7-(methoxymethyl)-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carbaldehyde.
| Compound Name | (5R,7R,8R)-8-hydroxy-7-(methoxymethyl)-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carbaldehyde |
|---|---|
| PubChem CID | 126603546 |
| Molecular Formula | C23H26O8 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | (5R,7R,8R)-8-hydroxy-7-(methoxymethyl)-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carbaldehyde |
| SMILES | COC[C@H]1C(C=O)[C@H](c2cc(OC)c(OC)c(OC)c2)c2cc3c(cc2[C@@H]1O)OCO3 |
| InChI | InChI=1S/C23H26O8/c1-26-10-16-15(9-24)21(12-5-19(27-2)23(29-4)20(6-12)28-3)13-7-17-18(31-11-30-17)8-14(13)22(16)25/h5-9,15-16,21-22,25H,10-11H2,1-4H3/t15?,16-,21+,22-/m0/s1 |
| InChIKey | ZDDMZICLXOHXGD-AHCKASEFSA-N |
| XLogP | 2.70 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|