C25H28O9 — CID 45484277
prop-2-enyl (5R,6S,7R,8R)-8-hydroxy-7-(hydroxymethyl)-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylate (PubChem CID 45484277) has the molecular formula C25H28O9 and a molecular weight of 472.49 g/mol. Its IUPAC name is prop-2-enyl (5R,6S,7R,8R)-8-hydroxy-7-(hydroxymethyl)-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylate.
| Compound Name | prop-2-enyl (5R,6S,7R,8R)-8-hydroxy-7-(hydroxymethyl)-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylate |
|---|---|
| PubChem CID | 45484277 |
| Molecular Formula | C25H28O9 |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | prop-2-enyl (5R,6S,7R,8R)-8-hydroxy-7-(hydroxymethyl)-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylate |
| SMILES | C=CCOC(=O)[C@H]1[C@H](c2cc(OC)c(OC)c(OC)c2)c2cc3c(cc2[C@H](O)[C@H]1CO)OCO3 |
| InChI | InChI=1S/C25H28O9/c1-5-6-32-25(28)22-16(11-26)23(27)15-10-18-17(33-12-34-18)9-14(15)21(22)13-7-19(29-2)24(31-4)20(8-13)30-3/h5,7-10,16,21-23,26-27H,1,6,11-12H2,2-4H3/t16-,21+,22+,23-/m0/s1 |
| InChIKey | SSRBMVMMBSDHJP-PARPOCPVSA-N |
| XLogP | 2.57 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|