C25H32O8 — CID 11102575
ethyl (1R,2S)-4-hydroxy-3-(hydroxymethyl)-7-methoxy-6-methyl-1-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 11102575) has the molecular formula C25H32O8 and a molecular weight of 460.52 g/mol. Its IUPAC name is ethyl (1R,2S)-4-hydroxy-3-(hydroxymethyl)-7-methoxy-6-methyl-1-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | ethyl (1R,2S)-4-hydroxy-3-(hydroxymethyl)-7-methoxy-6-methyl-1-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 11102575 |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | ethyl (1R,2S)-4-hydroxy-3-(hydroxymethyl)-7-methoxy-6-methyl-1-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(CO)C(O)c2cc(C)c(OC)cc2[C@H]1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C25H32O8/c1-7-33-25(28)22-17(12-26)23(27)16-8-13(2)18(29-3)11-15(16)21(22)14-9-19(30-4)24(32-6)20(10-14)31-5/h8-11,17,21-23,26-27H,7,12H2,1-6H3/t17?,21-,22-,23?/m1/s1 |
| InChIKey | PKRIKTPFZNLAOC-CRBRTNQVSA-N |
| XLogP | 3.00 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |