C21H25NO6 — CID 18606764
(1S,2S,3S,4R)-3-(aminomethyl)-4-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 18606764) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is (1S,2S,3S,4R)-3-(aminomethyl)-4-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid.
| Compound Name | (1S,2S,3S,4R)-3-(aminomethyl)-4-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 18606764 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (1S,2S,3S,4R)-3-(aminomethyl)-4-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
| SMILES | COc1cc([C@H]2c3ccccc3[C@H](O)[C@H](CN)[C@H]2C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C21H25NO6/c1-26-15-8-11(9-16(27-2)20(15)28-3)17-12-6-4-5-7-13(12)19(23)14(10-22)18(17)21(24)25/h4-9,14,17-19,23H,10,22H2,1-3H3,(H,24,25)/t14-,17+,18-,19+/m1/s1 |
| InChIKey | MUZBVPFDDTVLOP-FDPIWHGQSA-N |
| XLogP | 2.17 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |