C19H20O5 — CID 140974945
1-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-indene-2-carboxylic acid (PubChem CID 140974945) has the molecular formula C19H20O5 and a molecular weight of 328.36 g/mol. Its IUPAC name is 1-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-indene-2-carboxylic acid.
| Compound Name | 1-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-indene-2-carboxylic acid |
|---|---|
| PubChem CID | 140974945 |
| Molecular Formula | C19H20O5 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | 1-(3,4,5-trimethoxyphenyl)-2,3-dihydro-1H-indene-2-carboxylic acid |
| SMILES | COc1cc(C2c3ccccc3CC2C(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C19H20O5/c1-22-15-9-12(10-16(23-2)18(15)24-3)17-13-7-5-4-6-11(13)8-14(17)19(20)21/h4-7,9-10,14,17H,8H2,1-3H3,(H,20,21) |
| InChIKey | DQBBDDBENIHBNC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |