C17H16O2 — CID 18477073
1-phenyl-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid (PubChem CID 18477073) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is 1-phenyl-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid.
| Compound Name | 1-phenyl-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 18477073 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 1-phenyl-1,2,3,4-tetrahydronaphthalene-2-carboxylic acid |
| SMILES | O=C(O)C1CCc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C17H16O2/c18-17(19)15-11-10-12-6-4-5-9-14(12)16(15)13-7-2-1-3-8-13/h1-9,15-16H,10-11H2,(H,18,19) |
| InChIKey | FPBPVLHKLNMULL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |