C32H36N2O2 — CID 155468589
(1R,2R)-1-methyl-N-[[4-[[[(1R,2R)-1-methyl-1,2,3,4-tetrahydronaphthalene-2-carbonyl]amino]methyl]phenyl]methyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide (PubChem CID 155468589) has the molecular formula C32H36N2O2 and a molecular weight of 480.65 g/mol. Its IUPAC name is (1R,2R)-1-methyl-N-[[4-[[[(1R,2R)-1-methyl-1,2,3,4-tetrahydronaphthalene-2-carbonyl]amino]methyl]phenyl]methyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide.
| Compound Name | (1R,2R)-1-methyl-N-[[4-[[[(1R,2R)-1-methyl-1,2,3,4-tetrahydronaphthalene-2-carbonyl]amino]methyl]phenyl]methyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 155468589 |
| Molecular Formula | C32H36N2O2 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | (1R,2R)-1-methyl-N-[[4-[[[(1R,2R)-1-methyl-1,2,3,4-tetrahydronaphthalene-2-carbonyl]amino]methyl]phenyl]methyl]-1,2,3,4-tetrahydronaphthalene-2-carboxamide |
| SMILES | C[C@H]1c2ccccc2CC[C@H]1C(=O)NCc1ccc(CNC(=O)[C@@H]2CCc3ccccc3[C@@H]2C)cc1 |
| InChI | InChI=1S/C32H36N2O2/c1-21-27-9-5-3-7-25(27)15-17-29(21)31(35)33-19-23-11-13-24(14-12-23)20-34-32(36)30-18-16-26-8-4-6-10-28(26)22(30)2/h3-14,21-22,29-30H,15-20H2,1-2H3,(H,33,35)(H,34,36)/t21-,22-,29+,30+/m0/s1 |
| InChIKey | OJBBCZLDRRNTIN-PDNQGOMLSA-N |
| XLogP | 5.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |