C18H19NO2 — CID 134096597
(5-phenyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl) carbamate (PubChem CID 134096597) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (5-phenyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl) carbamate.
| Compound Name | (5-phenyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl) carbamate |
|---|---|
| PubChem CID | 134096597 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (5-phenyl-6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl) carbamate |
| SMILES | NC(=O)OC1CCCc2ccccc2C1c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c19-18(20)21-16-12-6-10-13-7-4-5-11-15(13)17(16)14-8-2-1-3-9-14/h1-5,7-9,11,16-17H,6,10,12H2,(H2,19,20) |
| InChIKey | PQECUQLJZWLWKW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |