C15H18F3NO2S — CID 56583651
2,2,2-trifluoroethyl N-[2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfanyl)ethyl]carbamate (PubChem CID 56583651) has the molecular formula C15H18F3NO2S and a molecular weight of 333.38 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfanyl)ethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfanyl)ethyl]carbamate |
|---|---|
| PubChem CID | 56583651 |
| Molecular Formula | C15H18F3NO2S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-(1,2,3,4-tetrahydronaphthalen-1-ylsulfanyl)ethyl]carbamate |
| SMILES | O=C(NCCSC1CCCc2ccccc21)OCC(F)(F)F |
| InChI | InChI=1S/C15H18F3NO2S/c16-15(17,18)10-21-14(20)19-8-9-22-13-7-3-5-11-4-1-2-6-12(11)13/h1-2,4,6,13H,3,5,7-10H2,(H,19,20) |
| InChIKey | QDOUTYIOLLZVSO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|