C21H22O8 — CID 14072855
8-hydroxy-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylic acid (PubChem CID 14072855) has the molecular formula C21H22O8 and a molecular weight of 402.40 g/mol. Its IUPAC name is 8-hydroxy-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylic acid.
| Compound Name | 8-hydroxy-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylic acid |
|---|---|
| PubChem CID | 14072855 |
| Molecular Formula | C21H22O8 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 8-hydroxy-5-(3,4,5-trimethoxyphenyl)-5,6,7,8-tetrahydrobenzo[f][1,3]benzodioxole-6-carboxylic acid |
| SMILES | COc1cc(C2c3cc4c(cc3C(O)CC2C(=O)O)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C21H22O8/c1-25-17-4-10(5-18(26-2)20(17)27-3)19-12-8-16-15(28-9-29-16)7-11(12)14(22)6-13(19)21(23)24/h4-5,7-8,13-14,19,22H,6,9H2,1-3H3,(H,23,24) |
| InChIKey | LDPUEORZDHJPHV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |